C10H16N4O4 — CID 123914070
(2S)-5-(diaminomethylideneamino)-2-(2,5-dihydroxypyrrol-1-yl)pentanoic acid (PubChem CID 123914070) has the molecular formula C10H16N4O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-(2,5-dihydroxypyrrol-1-yl)pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-(2,5-dihydroxypyrrol-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 123914070 |
| Molecular Formula | C10H16N4O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-(2,5-dihydroxypyrrol-1-yl)pentanoic acid |
| SMILES | NC(N)=NCCC[C@@H](C(=O)O)n1c(O)ccc1O |
| InChI | InChI=1S/C10H16N4O4/c11-10(12)13-5-1-2-6(9(17)18)14-7(15)3-4-8(14)16/h3-4,6,15-16H,1-2,5H2,(H,17,18)(H4,11,12,13)/t6-/m0/s1 |
| InChIKey | GAKDZFIDJKWQRD-LURJTMIESA-N |
| XLogP | -0.42 |
| TPSA | 147.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|