C7H9NO4 — CID 54281088
(2S)-2-(2,5-dihydroxypyrrol-1-yl)propanoic acid (PubChem CID 54281088) has the molecular formula C7H9NO4 and a molecular weight of 171.15 g/mol. Its IUPAC name is (2S)-2-(2,5-dihydroxypyrrol-1-yl)propanoic acid.
| Compound Name | (2S)-2-(2,5-dihydroxypyrrol-1-yl)propanoic acid |
|---|---|
| PubChem CID | 54281088 |
| Molecular Formula | C7H9NO4 |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | (2S)-2-(2,5-dihydroxypyrrol-1-yl)propanoic acid |
| SMILES | C[C@@H](C(=O)O)n1c(O)ccc1O |
| InChI | InChI=1S/C7H9NO4/c1-4(7(11)12)8-5(9)2-3-6(8)10/h2-4,9-10H,1H3,(H,11,12)/t4-/m0/s1 |
| InChIKey | RQVJXHKUSGZCJC-BYPYZUCNSA-N |
| XLogP | 0.54 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |