2-(2,5-dihydroxypyrrol-1-yl)-3-oxopentanedioic acid

C9H9NO7 — CID 54148814

IUPAC2-(2,5-dihydroxypyrrol-1-yl)-3-oxopentanedioic acid
SMILESO=C(O)CC(=O)C(C(=O)O)n1c(O)ccc1O
InChIInChI=1S/C9H9NO7/c11-4(3-7(14)15)8(9(16)17)10-5(12)1-2-6(10)13/h1-2,8,12-13H,3H2,(H,14,15)(H,16,17)
InChIKeyOGHASEHAHNTYNW-UHFFFAOYSA-N
MW243.17 g/mol
LogP-0.43
Rot. Bonds5

About 2-(2,5-dihydroxypyrrol-1-yl)-3-oxopentanedioic acid

2-(2,5-dihydroxypyrrol-1-yl)-3-oxopentanedioic acid (PubChem CID 54148814) has the molecular formula C9H9NO7 and a molecular weight of 243.17 g/mol. Its IUPAC name is 2-(2,5-dihydroxypyrrol-1-yl)-3-oxopentanedioic acid.

Molecular Properties

Compound Name2-(2,5-dihydroxypyrrol-1-yl)-3-oxopentanedioic acid
PubChem CID54148814
Molecular FormulaC9H9NO7
Molecular Weight243.17 g/mol
Exact Mass243.04
IUPAC Name2-(2,5-dihydroxypyrrol-1-yl)-3-oxopentanedioic acid
SMILESO=C(O)CC(=O)C(C(=O)O)n1c(O)ccc1O
InChIInChI=1S/C9H9NO7/c11-4(3-7(14)15)8(9(16)17)10-5(12)1-2-6(10)13/h1-2,8,12-13H,3H2,(H,14,15)(H,16,17)
InChIKeyOGHASEHAHNTYNW-UHFFFAOYSA-N
XLogP-0.43
TPSA137.06 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.17
LogP ≤ 5-0.43
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2-(2,5-dihydroxypyrrol-1-yl)-3-oxopentanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,5-dihydroxypyrrol-1-yl)-3-oxopentanedioic acid?
The IUPAC name of 2-(2,5-dihydroxypyrrol-1-yl)-3-oxopentanedioic acid (CID 54148814) is 2-(2,5-dihydroxypyrrol-1-yl)-3-oxopentanedioic acid.
What is the SMILES notation for 2-(2,5-dihydroxypyrrol-1-yl)-3-oxopentanedioic acid?
The canonical SMILES for 2-(2,5-dihydroxypyrrol-1-yl)-3-oxopentanedioic acid is O=C(O)CC(=O)C(C(=O)O)n1c(O)ccc1O.
What is the InChIKey of 2-(2,5-dihydroxypyrrol-1-yl)-3-oxopentanedioic acid?
The InChIKey is OGHASEHAHNTYNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO7/c11-4(3-7(14)15)8(9(16)17)10-5(12)1-2-6(10)13/h1-2,8,12-13H,3H2,(H,14,15)(H,16,17).
What are the key properties of 2-(2,5-dihydroxypyrrol-1-yl)-3-oxopentanedioic acid?
2-(2,5-dihydroxypyrrol-1-yl)-3-oxopentanedioic acid has a molecular weight of 243.17 g/mol, XLogP of -0.43, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dihydroxypyrrol-1-yl)-3-oxopentanedioic acid is sourced from PubChem (CID 54148814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).