C9H9NO7 — CID 54148814
2-(2,5-dihydroxypyrrol-1-yl)-3-oxopentanedioic acid (PubChem CID 54148814) has the molecular formula C9H9NO7 and a molecular weight of 243.17 g/mol. Its IUPAC name is 2-(2,5-dihydroxypyrrol-1-yl)-3-oxopentanedioic acid.
| Compound Name | 2-(2,5-dihydroxypyrrol-1-yl)-3-oxopentanedioic acid |
|---|---|
| PubChem CID | 54148814 |
| Molecular Formula | C9H9NO7 |
| Molecular Weight | 243.17 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | 2-(2,5-dihydroxypyrrol-1-yl)-3-oxopentanedioic acid |
| SMILES | O=C(O)CC(=O)C(C(=O)O)n1c(O)ccc1O |
| InChI | InChI=1S/C9H9NO7/c11-4(3-7(14)15)8(9(16)17)10-5(12)1-2-6(10)13/h1-2,8,12-13H,3H2,(H,14,15)(H,16,17) |
| InChIKey | OGHASEHAHNTYNW-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 137.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.17 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|