C9H12N2O4 — CID 54104390
(2,5-dihydroxypyrrol-1-yl) (2S)-pyrrolidine-2-carboxylate (PubChem CID 54104390) has the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) (2S)-pyrrolidine-2-carboxylate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) (2S)-pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 54104390 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) (2S)-pyrrolidine-2-carboxylate |
| SMILES | O=C(On1c(O)ccc1O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C9H12N2O4/c12-7-3-4-8(13)11(7)15-9(14)6-2-1-5-10-6/h3-4,6,10,12-13H,1-2,5H2/t6-/m0/s1 |
| InChIKey | NCSGORZTRVMMNI-LURJTMIESA-N |
| XLogP | -0.39 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |