C16H26N2O5 — CID 91158670
(2,5-dihydroxypyrrol-1-yl) 6-(6-deuteriohexan-2-ylamino)-6-oxohexanoate (PubChem CID 91158670) has the molecular formula C16H26N2O5 and a molecular weight of 327.40 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 6-(6-deuteriohexan-2-ylamino)-6-oxohexanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 6-(6-deuteriohexan-2-ylamino)-6-oxohexanoate |
|---|---|
| PubChem CID | 91158670 |
| Molecular Formula | C16H26N2O5 |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 6-(6-deuteriohexan-2-ylamino)-6-oxohexanoate |
| SMILES | [2H]CCCCC(C)NC(=O)CCCCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C16H26N2O5/c1-3-4-7-12(2)17-13(19)8-5-6-9-16(22)23-18-14(20)10-11-15(18)21/h10-12,20-21H,3-9H2,1-2H3,(H,17,19)/i1D |
| InChIKey | OQFMZZGJXBXQLJ-MICDWDOJSA-N |
| XLogP | 2.11 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|