C12H15F3N2O5 — CID 54125299
(2,5-dihydroxypyrrol-1-yl) 6-[(2,2,2-trifluoroacetyl)amino]hexanoate (PubChem CID 54125299) has the molecular formula C12H15F3N2O5 and a molecular weight of 324.26 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 6-[(2,2,2-trifluoroacetyl)amino]hexanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 6-[(2,2,2-trifluoroacetyl)amino]hexanoate |
|---|---|
| PubChem CID | 54125299 |
| Molecular Formula | C12H15F3N2O5 |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 6-[(2,2,2-trifluoroacetyl)amino]hexanoate |
| SMILES | O=C(CCCCCNC(=O)C(F)(F)F)On1c(O)ccc1O |
| InChI | InChI=1S/C12H15F3N2O5/c13-12(14,15)11(21)16-7-3-1-2-4-10(20)22-17-8(18)5-6-9(17)19/h5-6,18-19H,1-4,7H2,(H,16,21) |
| InChIKey | NQNMDTOCRNUOJU-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|