C9H4F9NO4 — CID 91224917
(2,5-dihydroxypyrrol-1-yl) 2,2,3,3,4,4,5,5,5-nonafluoropentanoate (PubChem CID 91224917) has the molecular formula C9H4F9NO4 and a molecular weight of 361.12 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2,2,3,3,4,4,5,5,5-nonafluoropentanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2,2,3,3,4,4,5,5,5-nonafluoropentanoate |
|---|---|
| PubChem CID | 91224917 |
| Molecular Formula | C9H4F9NO4 |
| Molecular Weight | 361.12 g/mol |
| Exact Mass | 361.00 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2,2,3,3,4,4,5,5,5-nonafluoropentanoate |
| SMILES | O=C(On1c(O)ccc1O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H4F9NO4/c10-6(11,7(12,13)8(14,15)9(16,17)18)5(22)23-19-3(20)1-2-4(19)21/h1-2,20-21H |
| InChIKey | YTTDMTADBQUKBJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.12 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|