About (2,5-dihydroxypyrrol-1-yl) 2-bromoacetate
(2,5-dihydroxypyrrol-1-yl) 2-bromoacetate (PubChem CID 54138195) has the molecular formula C6H6BrNO4
and a molecular weight of 236.02 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-bromoacetate.
Molecular Properties
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-bromoacetate |
| PubChem CID | 54138195 |
| Molecular Formula | C6H6BrNO4 |
| Molecular Weight | 236.02 g/mol |
| Exact Mass | 234.95 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-bromoacetate |
| SMILES | O=C(CBr)On1c(O)ccc1O |
| InChI | InChI=1S/C6H6BrNO4/c7-3-6(11)12-8-4(9)1-2-5(8)10/h1-2,9-10H,3H2 |
| InChIKey | NZFCQYPFFVYCLF-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.02 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dihydroxypyrrol-1-yl) 2-bromoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dihydroxypyrrol-1-yl) 2-bromoacetate?
The IUPAC name of (2,5-dihydroxypyrrol-1-yl) 2-bromoacetate (CID 54138195) is (2,5-dihydroxypyrrol-1-yl) 2-bromoacetate.
What is the SMILES notation for (2,5-dihydroxypyrrol-1-yl) 2-bromoacetate?
The canonical SMILES for (2,5-dihydroxypyrrol-1-yl) 2-bromoacetate is O=C(CBr)On1c(O)ccc1O.
What is the InChIKey of (2,5-dihydroxypyrrol-1-yl) 2-bromoacetate?
The InChIKey is NZFCQYPFFVYCLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrNO4/c7-3-6(11)12-8-4(9)1-2-5(8)10/h1-2,9-10H,3H2.
What are the key properties of (2,5-dihydroxypyrrol-1-yl) 2-bromoacetate?
(2,5-dihydroxypyrrol-1-yl) 2-bromoacetate has a molecular weight of 236.02 g/mol, XLogP of 0.25, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxypyrrol-1-yl) 2-bromoacetate is sourced from PubChem (CID 54138195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).