C12H4F15NO4 — CID 91306777
(2,5-dihydroxypyrrol-1-yl) 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate (PubChem CID 91306777) has the molecular formula C12H4F15NO4 and a molecular weight of 511.14 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate |
|---|---|
| PubChem CID | 91306777 |
| Molecular Formula | C12H4F15NO4 |
| Molecular Weight | 511.14 g/mol |
| Exact Mass | 510.99 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate |
| SMILES | O=C(On1c(O)ccc1O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H4F15NO4/c13-6(14,5(31)32-28-3(29)1-2-4(28)30)7(15,16)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)27/h1-2,29-30H |
| InChIKey | NNDLPBXDILTVJW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.14 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|