C19H25FN2O5 — CID 123154022
(2,5-dihydroxypyrrol-1-yl) 6-[(1-fluorocyclooct-2-yne-1-carbonyl)amino]hexanoate (PubChem CID 123154022) has the molecular formula C19H25FN2O5 and a molecular weight of 380.42 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 6-[(1-fluorocyclooct-2-yne-1-carbonyl)amino]hexanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 6-[(1-fluorocyclooct-2-yne-1-carbonyl)amino]hexanoate |
|---|---|
| PubChem CID | 123154022 |
| Molecular Formula | C19H25FN2O5 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 6-[(1-fluorocyclooct-2-yne-1-carbonyl)amino]hexanoate |
| SMILES | O=C(CCCCCNC(=O)C1(F)C#CCCCCC1)On1c(O)ccc1O |
| InChI | InChI=1S/C19H25FN2O5/c20-19(12-6-2-1-3-7-13-19)18(26)21-14-8-4-5-9-17(25)27-22-15(23)10-11-16(22)24/h10-11,23-24H,1-6,8-9,12,14H2,(H,21,26) |
| InChIKey | XTRPQRDMYALNNR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|