C34H51N5O9 — CID 91053181
(2,5-dihydroxypyrrol-1-yl) 6-[6-[6-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]hexanoylamino]hexanoylamino]hexanoate (PubChem CID 91053181) has the molecular formula C34H51N5O9 and a molecular weight of 673.81 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 6-[6-[6-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]hexanoylamino]hexanoylamino]hexanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 6-[6-[6-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]hexanoylamino]hexanoylamino]hexanoate |
|---|---|
| PubChem CID | 91053181 |
| Molecular Formula | C34H51N5O9 |
| Molecular Weight | 673.81 g/mol |
| Exact Mass | 673.37 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 6-[6-[6-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]hexanoylamino]hexanoylamino]hexanoate |
| SMILES | O=C(CCCCCNC(=O)CCCCCNC(=O)C1CCC(CN2C(=O)C=CC2=O)CC1)NCCCCCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C34H51N5O9/c40-27(36-22-8-3-6-12-33(46)48-39-31(44)19-20-32(39)45)10-4-1-7-21-35-28(41)11-5-2-9-23-37-34(47)26-15-13-25(14-16-26)24-38-29(42)17-18-30(38)43/h17-20,25-26,44-45H,1-16,21-24H2,(H,35,41)(H,36,40)(H,37,47) |
| InChIKey | FLIWTFYPSRFMDN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 196.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.81 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|