C13H18N2O5 — CID 54176926
(2,5-dihydroxypyrrol-1-yl) 6-(prop-2-enoylamino)hexanoate (PubChem CID 54176926) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 6-(prop-2-enoylamino)hexanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 6-(prop-2-enoylamino)hexanoate |
|---|---|
| PubChem CID | 54176926 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 6-(prop-2-enoylamino)hexanoate |
| SMILES | C=CC(=O)NCCCCCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C13H18N2O5/c1-2-10(16)14-9-5-3-4-6-13(19)20-15-11(17)7-8-12(15)18/h2,7-8,17-18H,1,3-6,9H2,(H,14,16) |
| InChIKey | OZATVXCRYHBOJP-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|