C12H17F3N2O5 — CID 91392457
N-[6-(2,5-dihydroxypyrrol-1-yl)oxy-6-hydroxyhexyl]-2,2,2-trifluoroacetamide (PubChem CID 91392457) has the molecular formula C12H17F3N2O5 and a molecular weight of 326.27 g/mol. Its IUPAC name is N-[6-(2,5-dihydroxypyrrol-1-yl)oxy-6-hydroxyhexyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[6-(2,5-dihydroxypyrrol-1-yl)oxy-6-hydroxyhexyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 91392457 |
| Molecular Formula | C12H17F3N2O5 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | N-[6-(2,5-dihydroxypyrrol-1-yl)oxy-6-hydroxyhexyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(NCCCCCC(O)On1c(O)ccc1O)C(F)(F)F |
| InChI | InChI=1S/C12H17F3N2O5/c13-12(14,15)11(21)16-7-3-1-2-4-10(20)22-17-8(18)5-6-9(17)19/h5-6,10,18-20H,1-4,7H2,(H,16,21) |
| InChIKey | QNDLQRXLDJWKSO-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|