C21H24F3N3O6 — CID 123293423
(2,5-dihydroxypyrrol-1-yl) 6-(nona-3,5-diynoylamino)-2-[(2,2,2-trifluoroacetyl)amino]hexanoate (PubChem CID 123293423) has the molecular formula C21H24F3N3O6 and a molecular weight of 471.43 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 6-(nona-3,5-diynoylamino)-2-[(2,2,2-trifluoroacetyl)amino]hexanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 6-(nona-3,5-diynoylamino)-2-[(2,2,2-trifluoroacetyl)amino]hexanoate |
|---|---|
| PubChem CID | 123293423 |
| Molecular Formula | C21H24F3N3O6 |
| Molecular Weight | 471.43 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 6-(nona-3,5-diynoylamino)-2-[(2,2,2-trifluoroacetyl)amino]hexanoate |
| SMILES | CCCC#CC#CCC(=O)NCCCCC(NC(=O)C(F)(F)F)C(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C21H24F3N3O6/c1-2-3-4-5-6-7-11-16(28)25-14-9-8-10-15(26-20(32)21(22,23)24)19(31)33-27-17(29)12-13-18(27)30/h12-13,15,29-30H,2-3,8-11,14H2,1H3,(H,25,28)(H,26,32) |
| InChIKey | CFUARZMLQUJZEN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.43 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|