C11H13F3N2O5 — CID 91522402
(2,5-dihydroxypyrrol-1-yl) 5-[(2,2,2-trifluoroacetyl)amino]pentanoate (PubChem CID 91522402) has the molecular formula C11H13F3N2O5 and a molecular weight of 310.23 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 5-[(2,2,2-trifluoroacetyl)amino]pentanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 5-[(2,2,2-trifluoroacetyl)amino]pentanoate |
|---|---|
| PubChem CID | 91522402 |
| Molecular Formula | C11H13F3N2O5 |
| Molecular Weight | 310.23 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 5-[(2,2,2-trifluoroacetyl)amino]pentanoate |
| SMILES | O=C(CCCCNC(=O)C(F)(F)F)On1c(O)ccc1O |
| InChI | InChI=1S/C11H13F3N2O5/c12-11(13,14)10(20)15-6-2-1-3-9(19)21-16-7(17)4-5-8(16)18/h4-5,17-18H,1-3,6H2,(H,15,20) |
| InChIKey | ORPSVYWFLJJCPZ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|