C13H15N3O8 — CID 54170576
bis(2,5-dihydroxypyrrol-1-yl) (2S)-2-aminopentanedioate (PubChem CID 54170576) has the molecular formula C13H15N3O8 and a molecular weight of 341.28 g/mol. Its IUPAC name is bis(2,5-dihydroxypyrrol-1-yl) (2S)-2-aminopentanedioate.
| Compound Name | bis(2,5-dihydroxypyrrol-1-yl) (2S)-2-aminopentanedioate |
|---|---|
| PubChem CID | 54170576 |
| Molecular Formula | C13H15N3O8 |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | bis(2,5-dihydroxypyrrol-1-yl) (2S)-2-aminopentanedioate |
| SMILES | N[C@@H](CCC(=O)On1c(O)ccc1O)C(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C13H15N3O8/c14-7(13(22)24-16-10(19)4-5-11(16)20)1-6-12(21)23-15-8(17)2-3-9(15)18/h2-5,7,17-20H,1,6,14H2/t7-/m0/s1 |
| InChIKey | OUSRWJOBRGGURE-ZETCQYMHSA-N |
| XLogP | -1.17 |
| TPSA | 169.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |