C13H14N2O8 — CID 54169682
2,2-bis(2,5-dihydroxypyrrol-1-yl)pentanedioic acid (PubChem CID 54169682) has the molecular formula C13H14N2O8 and a molecular weight of 326.26 g/mol. Its IUPAC name is 2,2-bis(2,5-dihydroxypyrrol-1-yl)pentanedioic acid.
| Compound Name | 2,2-bis(2,5-dihydroxypyrrol-1-yl)pentanedioic acid |
|---|---|
| PubChem CID | 54169682 |
| Molecular Formula | C13H14N2O8 |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 2,2-bis(2,5-dihydroxypyrrol-1-yl)pentanedioic acid |
| SMILES | O=C(O)CCC(C(=O)O)(n1c(O)ccc1O)n1c(O)ccc1O |
| InChI | InChI=1S/C13H14N2O8/c16-7-1-2-8(17)14(7)13(12(22)23,6-5-11(20)21)15-9(18)3-4-10(15)19/h1-4,16-19H,5-6H2,(H,20,21)(H,22,23) |
| InChIKey | OUCZGGJOROUMGS-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 165.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |