C16H20N2O8 — CID 54467247
2,2-bis(2,5-dihydroxypyrrol-1-yl)octanedioic acid (PubChem CID 54467247) has the molecular formula C16H20N2O8 and a molecular weight of 368.34 g/mol. Its IUPAC name is 2,2-bis(2,5-dihydroxypyrrol-1-yl)octanedioic acid.
| Compound Name | 2,2-bis(2,5-dihydroxypyrrol-1-yl)octanedioic acid |
|---|---|
| PubChem CID | 54467247 |
| Molecular Formula | C16H20N2O8 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 2,2-bis(2,5-dihydroxypyrrol-1-yl)octanedioic acid |
| SMILES | O=C(O)CCCCCC(C(=O)O)(n1c(O)ccc1O)n1c(O)ccc1O |
| InChI | InChI=1S/C16H20N2O8/c19-10-5-6-11(20)17(10)16(15(25)26,9-3-1-2-4-14(23)24)18-12(21)7-8-13(18)22/h5-8,19-22H,1-4,9H2,(H,23,24)(H,25,26) |
| InChIKey | XFUGYMOWVKUBNO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 165.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|