C12H12N2O8 — CID 54222453
2,2-bis(2,5-dihydroxypyrrol-1-yl)butanedioic acid (PubChem CID 54222453) has the molecular formula C12H12N2O8 and a molecular weight of 312.23 g/mol. Its IUPAC name is 2,2-bis(2,5-dihydroxypyrrol-1-yl)butanedioic acid.
| Compound Name | 2,2-bis(2,5-dihydroxypyrrol-1-yl)butanedioic acid |
|---|---|
| PubChem CID | 54222453 |
| Molecular Formula | C12H12N2O8 |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 2,2-bis(2,5-dihydroxypyrrol-1-yl)butanedioic acid |
| SMILES | O=C(O)CC(C(=O)O)(n1c(O)ccc1O)n1c(O)ccc1O |
| InChI | InChI=1S/C12H12N2O8/c15-6-1-2-7(16)13(6)12(11(21)22,5-10(19)20)14-8(17)3-4-9(14)18/h1-4,15-18H,5H2,(H,19,20)(H,21,22) |
| InChIKey | QDNVTYYGFTWEPG-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 165.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |