C11H12N2O6S2 — CID 57003836
3,3-bis(2,5-dihydroxypyrrol-1-yl)-2,3-bis(sulfanyl)propanoic acid (PubChem CID 57003836) has the molecular formula C11H12N2O6S2 and a molecular weight of 332.36 g/mol. Its IUPAC name is 3,3-bis(2,5-dihydroxypyrrol-1-yl)-2,3-bis(sulfanyl)propanoic acid.
| Compound Name | 3,3-bis(2,5-dihydroxypyrrol-1-yl)-2,3-bis(sulfanyl)propanoic acid |
|---|---|
| PubChem CID | 57003836 |
| Molecular Formula | C11H12N2O6S2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 3,3-bis(2,5-dihydroxypyrrol-1-yl)-2,3-bis(sulfanyl)propanoic acid |
| SMILES | O=C(O)C(S)C(S)(n1c(O)ccc1O)n1c(O)ccc1O |
| InChI | InChI=1S/C11H12N2O6S2/c14-5-1-2-6(15)12(5)11(21,9(20)10(18)19)13-7(16)3-4-8(13)17/h1-4,9,14-17,20-21H,(H,18,19) |
| InChIKey | QDFFXRHRGFYNJW-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|