C10H13NO6S2 — CID 54098779
3-[[3-(2,5-dihydroxypyrrol-1-yl)oxy-3-oxopropyl]disulfanyl]propanoic acid (PubChem CID 54098779) has the molecular formula C10H13NO6S2 and a molecular weight of 307.35 g/mol. Its IUPAC name is 3-[[3-(2,5-dihydroxypyrrol-1-yl)oxy-3-oxopropyl]disulfanyl]propanoic acid.
| Compound Name | 3-[[3-(2,5-dihydroxypyrrol-1-yl)oxy-3-oxopropyl]disulfanyl]propanoic acid |
|---|---|
| PubChem CID | 54098779 |
| Molecular Formula | C10H13NO6S2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 3-[[3-(2,5-dihydroxypyrrol-1-yl)oxy-3-oxopropyl]disulfanyl]propanoic acid |
| SMILES | O=C(O)CCSSCCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C10H13NO6S2/c12-7-1-2-8(13)11(7)17-10(16)4-6-19-18-5-3-9(14)15/h1-2,12-13H,3-6H2,(H,14,15) |
| InChIKey | MZBIAJVGBDNEGS-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|