C9H8N2O5 — CID 54196158
bis(2,5-dihydroxypyrrol-1-yl)methanone (PubChem CID 54196158) has the molecular formula C9H8N2O5 and a molecular weight of 224.17 g/mol. Its IUPAC name is bis(2,5-dihydroxypyrrol-1-yl)methanone.
| Compound Name | bis(2,5-dihydroxypyrrol-1-yl)methanone |
|---|---|
| PubChem CID | 54196158 |
| Molecular Formula | C9H8N2O5 |
| Molecular Weight | 224.17 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | bis(2,5-dihydroxypyrrol-1-yl)methanone |
| SMILES | O=C(n1c(O)ccc1O)n1c(O)ccc1O |
| InChI | InChI=1S/C9H8N2O5/c12-5-1-2-6(13)10(5)9(16)11-7(14)3-4-8(11)15/h1-4,12-15H |
| InChIKey | PLYKJVJOBNKFOJ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 107.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.17 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |