C8H8N2O4S — CID 54463532
1-(2,5-dihydroxypyrrol-1-yl)sulfanylpyrrole-2,5-diol (PubChem CID 54463532) has the molecular formula C8H8N2O4S and a molecular weight of 228.23 g/mol. Its IUPAC name is 1-(2,5-dihydroxypyrrol-1-yl)sulfanylpyrrole-2,5-diol.
| Compound Name | 1-(2,5-dihydroxypyrrol-1-yl)sulfanylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 54463532 |
| Molecular Formula | C8H8N2O4S |
| Molecular Weight | 228.23 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 1-(2,5-dihydroxypyrrol-1-yl)sulfanylpyrrole-2,5-diol |
| SMILES | Oc1ccc(O)n1Sn1c(O)ccc1O |
| InChI | InChI=1S/C8H8N2O4S/c11-5-1-2-6(12)9(5)15-10-7(13)3-4-8(10)14/h1-4,11-14H |
| InChIKey | XDGPXEMUMJKUAE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 90.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |