C9H10N2O4 — CID 54124926
1-[(2,5-dihydroxypyrrol-1-yl)methyl]pyrrole-2,5-diol (PubChem CID 54124926) has the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. Its IUPAC name is 1-[(2,5-dihydroxypyrrol-1-yl)methyl]pyrrole-2,5-diol.
| Compound Name | 1-[(2,5-dihydroxypyrrol-1-yl)methyl]pyrrole-2,5-diol |
|---|---|
| PubChem CID | 54124926 |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 1-[(2,5-dihydroxypyrrol-1-yl)methyl]pyrrole-2,5-diol |
| SMILES | Oc1ccc(O)n1Cn1c(O)ccc1O |
| InChI | InChI=1S/C9H10N2O4/c12-6-1-2-7(13)10(6)5-11-8(14)3-4-9(11)15/h1-4,12-15H,5H2 |
| InChIKey | UHSCITFUWOXALU-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 90.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |