C8H8N2O5S — CID 123849807
1-(2,5-dihydroxypyrrol-1-yl)sulfinylpyrrole-2,5-diol (PubChem CID 123849807) has the molecular formula C8H8N2O5S and a molecular weight of 244.23 g/mol. Its IUPAC name is 1-(2,5-dihydroxypyrrol-1-yl)sulfinylpyrrole-2,5-diol.
| Compound Name | 1-(2,5-dihydroxypyrrol-1-yl)sulfinylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 123849807 |
| Molecular Formula | C8H8N2O5S |
| Molecular Weight | 244.23 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | 1-(2,5-dihydroxypyrrol-1-yl)sulfinylpyrrole-2,5-diol |
| SMILES | O=S(n1c(O)ccc1O)n1c(O)ccc1O |
| InChI | InChI=1S/C8H8N2O5S/c11-5-1-2-6(12)9(5)16(15)10-7(13)3-4-8(10)14/h1-4,11-14H |
| InChIKey | AVXAKKYPFWGGDP-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 107.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.23 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |