C17H28N2O2 — CID 90710890
1-[(dicyclohexylamino)methyl]pyrrole-2,5-diol (PubChem CID 90710890) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 1-[(dicyclohexylamino)methyl]pyrrole-2,5-diol.
| Compound Name | 1-[(dicyclohexylamino)methyl]pyrrole-2,5-diol |
|---|---|
| PubChem CID | 90710890 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 1-[(dicyclohexylamino)methyl]pyrrole-2,5-diol |
| SMILES | Oc1ccc(O)n1CN(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C17H28N2O2/c20-16-11-12-17(21)19(16)13-18(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h11-12,14-15,20-21H,1-10,13H2 |
| InChIKey | BVNROTWKMXQJTE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 48.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |