C11H12N2O6 — CID 57263465
3,3-bis(2,5-dihydroxypyrrol-1-yl)propanoic acid (PubChem CID 57263465) has the molecular formula C11H12N2O6 and a molecular weight of 268.23 g/mol. Its IUPAC name is 3,3-bis(2,5-dihydroxypyrrol-1-yl)propanoic acid.
| Compound Name | 3,3-bis(2,5-dihydroxypyrrol-1-yl)propanoic acid |
|---|---|
| PubChem CID | 57263465 |
| Molecular Formula | C11H12N2O6 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 3,3-bis(2,5-dihydroxypyrrol-1-yl)propanoic acid |
| SMILES | O=C(O)CC(n1c(O)ccc1O)n1c(O)ccc1O |
| InChI | InChI=1S/C11H12N2O6/c14-7-1-2-8(15)12(7)6(5-11(18)19)13-9(16)3-4-10(13)17/h1-4,6,14-17H,5H2,(H,18,19) |
| InChIKey | SXCLNGNEYDPSNY-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |