C8H10BrNO4 — CID 91306695
2-bromo-3-(2,5-dihydroxypyrrol-1-yl)-2-methylpropanoic acid (PubChem CID 91306695) has the molecular formula C8H10BrNO4 and a molecular weight of 264.07 g/mol. Its IUPAC name is 2-bromo-3-(2,5-dihydroxypyrrol-1-yl)-2-methylpropanoic acid.
| Compound Name | 2-bromo-3-(2,5-dihydroxypyrrol-1-yl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 91306695 |
| Molecular Formula | C8H10BrNO4 |
| Molecular Weight | 264.07 g/mol |
| Exact Mass | 262.98 |
| IUPAC Name | 2-bromo-3-(2,5-dihydroxypyrrol-1-yl)-2-methylpropanoic acid |
| SMILES | CC(Br)(Cn1c(O)ccc1O)C(=O)O |
| InChI | InChI=1S/C8H10BrNO4/c1-8(9,7(13)14)4-10-5(11)2-3-6(10)12/h2-3,11-12H,4H2,1H3,(H,13,14) |
| InChIKey | JYCSNTHRJDLTDV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.07 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|