C11H19N2O4+ — CID 90703472
[4-(2,5-dihydroxypyrrol-1-yl)oxy-4-oxobutyl]-trimethylazanium (PubChem CID 90703472) has the molecular formula C11H19N2O4+ and a molecular weight of 243.28 g/mol. Its IUPAC name is [4-(2,5-dihydroxypyrrol-1-yl)oxy-4-oxobutyl]-trimethylazanium.
| Compound Name | [4-(2,5-dihydroxypyrrol-1-yl)oxy-4-oxobutyl]-trimethylazanium |
|---|---|
| PubChem CID | 90703472 |
| Molecular Formula | C11H19N2O4+ |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | [4-(2,5-dihydroxypyrrol-1-yl)oxy-4-oxobutyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CCCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C11H18N2O4/c1-13(2,3)8-4-5-11(16)17-12-9(14)6-7-10(12)15/h6-7H,4-5,8H2,1-3H3,(H-,14,15)/p+1 |
| InChIKey | FQRRTIWQJYTFHH-UHFFFAOYSA-O |
| XLogP | 0.34 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|