C21H20N4O12 — CID 54068233
2,2,3,3-tetrakis(2,5-dihydroxypyrrol-1-yl)pentanedioic acid (PubChem CID 54068233) has the molecular formula C21H20N4O12 and a molecular weight of 520.41 g/mol. Its IUPAC name is 2,2,3,3-tetrakis(2,5-dihydroxypyrrol-1-yl)pentanedioic acid.
| Compound Name | 2,2,3,3-tetrakis(2,5-dihydroxypyrrol-1-yl)pentanedioic acid |
|---|---|
| PubChem CID | 54068233 |
| Molecular Formula | C21H20N4O12 |
| Molecular Weight | 520.41 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | 2,2,3,3-tetrakis(2,5-dihydroxypyrrol-1-yl)pentanedioic acid |
| SMILES | O=C(O)CC(n1c(O)ccc1O)(n1c(O)ccc1O)C(C(=O)O)(n1c(O)ccc1O)n1c(O)ccc1O |
| InChI | InChI=1S/C21H20N4O12/c26-10-1-2-11(27)22(10)20(9-18(34)35,23-12(28)3-4-13(23)29)21(19(36)37,24-14(30)5-6-15(24)31)25-16(32)7-8-17(25)33/h1-8,26-33H,9H2,(H,34,35)(H,36,37) |
| InChIKey | MEOBWHLVWZLGPS-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 256.16 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.41 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |