C20H18N4O12 — CID 91431392
2,2,3,3-tetrakis(2,5-dihydroxypyrrol-1-yl)butanedioic acid (PubChem CID 91431392) has the molecular formula C20H18N4O12 and a molecular weight of 506.38 g/mol. Its IUPAC name is 2,2,3,3-tetrakis(2,5-dihydroxypyrrol-1-yl)butanedioic acid.
| Compound Name | 2,2,3,3-tetrakis(2,5-dihydroxypyrrol-1-yl)butanedioic acid |
|---|---|
| PubChem CID | 91431392 |
| Molecular Formula | C20H18N4O12 |
| Molecular Weight | 506.38 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | 2,2,3,3-tetrakis(2,5-dihydroxypyrrol-1-yl)butanedioic acid |
| SMILES | O=C(O)C(n1c(O)ccc1O)(n1c(O)ccc1O)C(C(=O)O)(n1c(O)ccc1O)n1c(O)ccc1O |
| InChI | InChI=1S/C20H18N4O12/c25-9-1-2-10(26)21(9)19(17(33)34,22-11(27)3-4-12(22)28)20(18(35)36,23-13(29)5-6-14(23)30)24-15(31)7-8-16(24)32/h1-8,25-32H,(H,33,34)(H,35,36) |
| InChIKey | VXJYMYSGCHHDFQ-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 256.16 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.38 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |