C19H18N4O14 — CID 91229191
2,2,3,3-tetrakis(2,3,5-trihydroxypyrrol-1-yl)propanoic acid (PubChem CID 91229191) has the molecular formula C19H18N4O14 and a molecular weight of 526.37 g/mol. Its IUPAC name is 2,2,3,3-tetrakis(2,3,5-trihydroxypyrrol-1-yl)propanoic acid.
| Compound Name | 2,2,3,3-tetrakis(2,3,5-trihydroxypyrrol-1-yl)propanoic acid |
|---|---|
| PubChem CID | 91229191 |
| Molecular Formula | C19H18N4O14 |
| Molecular Weight | 526.37 g/mol |
| Exact Mass | 526.08 |
| IUPAC Name | 2,2,3,3-tetrakis(2,3,5-trihydroxypyrrol-1-yl)propanoic acid |
| SMILES | O=C(O)C(C(n1c(O)cc(O)c1O)n1c(O)cc(O)c1O)(n1c(O)cc(O)c1O)n1c(O)cc(O)c1O |
| InChI | InChI=1S/C19H18N4O14/c24-5-1-9(28)20(13(5)32)17(21-10(29)2-6(25)14(21)33)19(18(36)37,22-11(30)3-7(26)15(22)34)23-12(31)4-8(27)16(23)35/h1-4,17,24-35H,(H,36,37) |
| InChIKey | QPZDJCJYKVZOBT-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 299.78 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.37 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 17 |