C14H15N5O8 — CID 91218574
bis(2,5-dihydroxypyrrol-1-yl) 3-(azidomethyl)pentanedioate (PubChem CID 91218574) has the molecular formula C14H15N5O8 and a molecular weight of 381.30 g/mol. Its IUPAC name is bis(2,5-dihydroxypyrrol-1-yl) 3-(azidomethyl)pentanedioate.
| Compound Name | bis(2,5-dihydroxypyrrol-1-yl) 3-(azidomethyl)pentanedioate |
|---|---|
| PubChem CID | 91218574 |
| Molecular Formula | C14H15N5O8 |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | bis(2,5-dihydroxypyrrol-1-yl) 3-(azidomethyl)pentanedioate |
| SMILES | [N-]=[N+]=NCC(CC(=O)On1c(O)ccc1O)CC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C14H15N5O8/c15-17-16-7-8(5-13(24)26-18-9(20)1-2-10(18)21)6-14(25)27-19-11(22)3-4-12(19)23/h1-4,8,20-23H,5-7H2 |
| InChIKey | FPYSDMLJUMPGMZ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 192.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|