C9H11NO6 — CID 54149107
2-(2,5-dihydroxypyrrol-1-yl)pentanedioic acid (PubChem CID 54149107) has the molecular formula C9H11NO6 and a molecular weight of 229.19 g/mol. Its IUPAC name is 2-(2,5-dihydroxypyrrol-1-yl)pentanedioic acid.
| Compound Name | 2-(2,5-dihydroxypyrrol-1-yl)pentanedioic acid |
|---|---|
| PubChem CID | 54149107 |
| Molecular Formula | C9H11NO6 |
| Molecular Weight | 229.19 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 2-(2,5-dihydroxypyrrol-1-yl)pentanedioic acid |
| SMILES | O=C(O)CCC(C(=O)O)n1c(O)ccc1O |
| InChI | InChI=1S/C9H11NO6/c11-6-2-3-7(12)10(6)5(9(15)16)1-4-8(13)14/h2-3,5,11-12H,1,4H2,(H,13,14)(H,15,16) |
| InChIKey | OGMIUTPVNVGIQE-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 119.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.19 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |