C7H9NO7S — CID 91329657
3-(2,5-dihydroxypyrrol-1-yl)-3-sulfopropanoic acid (PubChem CID 91329657) has the molecular formula C7H9NO7S and a molecular weight of 251.22 g/mol. Its IUPAC name is 3-(2,5-dihydroxypyrrol-1-yl)-3-sulfopropanoic acid.
| Compound Name | 3-(2,5-dihydroxypyrrol-1-yl)-3-sulfopropanoic acid |
|---|---|
| PubChem CID | 91329657 |
| Molecular Formula | C7H9NO7S |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.01 |
| IUPAC Name | 3-(2,5-dihydroxypyrrol-1-yl)-3-sulfopropanoic acid |
| SMILES | O=C(O)CC(n1c(O)ccc1O)S(=O)(=O)O |
| InChI | InChI=1S/C7H9NO7S/c9-4-1-2-5(10)8(4)6(3-7(11)12)16(13,14)15/h1-2,6,9-10H,3H2,(H,11,12)(H,13,14,15) |
| InChIKey | VGEVSOLSXHSOEW-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 137.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|