C9H12N2O5S — CID 90935387
(2,5-dihydroxypyrrol-1-yl) 2-(2-sulfanylpropanoylamino)acetate (PubChem CID 90935387) has the molecular formula C9H12N2O5S and a molecular weight of 260.27 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-(2-sulfanylpropanoylamino)acetate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-(2-sulfanylpropanoylamino)acetate |
|---|---|
| PubChem CID | 90935387 |
| Molecular Formula | C9H12N2O5S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-(2-sulfanylpropanoylamino)acetate |
| SMILES | CC(S)C(=O)NCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C9H12N2O5S/c1-5(17)9(15)10-4-8(14)16-11-6(12)2-3-7(11)13/h2-3,5,12-13,17H,4H2,1H3,(H,10,15) |
| InChIKey | SAUWUENBPOHKAM-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|