C19H26N2O9S — CID 91581572
1-[8-(2,5-dioxopyrrol-1-yl)undecanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid (PubChem CID 91581572) has the molecular formula C19H26N2O9S and a molecular weight of 458.49 g/mol. Its IUPAC name is 1-[8-(2,5-dioxopyrrol-1-yl)undecanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid.
| Compound Name | 1-[8-(2,5-dioxopyrrol-1-yl)undecanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 91581572 |
| Molecular Formula | C19H26N2O9S |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 1-[8-(2,5-dioxopyrrol-1-yl)undecanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid |
| SMILES | CCCC(CCCCCCC(=O)On1c(O)cc(S(=O)(=O)O)c1O)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C19H26N2O9S/c1-2-7-13(20-15(22)10-11-16(20)23)8-5-3-4-6-9-18(25)30-21-17(24)12-14(19(21)26)31(27,28)29/h10-13,24,26H,2-9H2,1H3,(H,27,28,29) |
| InChIKey | YNVQSQZYXLSQFI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 163.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|