C18H17F12IN2O8S — CID 91476457
1-[4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-12-[(2-iodoacetyl)amino]dodecanoyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid (PubChem CID 91476457) has the molecular formula C18H17F12IN2O8S and a molecular weight of 776.29 g/mol. Its IUPAC name is 1-[4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-12-[(2-iodoacetyl)amino]dodecanoyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid.
| Compound Name | 1-[4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-12-[(2-iodoacetyl)amino]dodecanoyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 91476457 |
| Molecular Formula | C18H17F12IN2O8S |
| Molecular Weight | 776.29 g/mol |
| Exact Mass | 775.96 |
| IUPAC Name | 1-[4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-12-[(2-iodoacetyl)amino]dodecanoyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid |
| SMILES | O=C(CI)NCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCC(=O)On1c(O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C18H17F12IN2O8S/c19-13(20,3-1-5-32-9(34)7-31)15(23,24)17(27,28)18(29,30)16(25,26)14(21,22)4-2-11(36)41-33-10(35)6-8(12(33)37)42(38,39)40/h6,35,37H,1-5,7H2,(H,32,34)(H,38,39,40) |
| InChIKey | SLRIRZBDXAPQKK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 155.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.29 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|