C19H25N2O8S- — CID 123259839
1-[11-(2,5-dioxopyrrol-1-yl)undecanoyloxy]-2,5-dihydroxypyrrole-3-sulfinate (PubChem CID 123259839) has the molecular formula C19H25N2O8S- and a molecular weight of 441.48 g/mol. Its IUPAC name is 1-[11-(2,5-dioxopyrrol-1-yl)undecanoyloxy]-2,5-dihydroxypyrrole-3-sulfinate.
| Compound Name | 1-[11-(2,5-dioxopyrrol-1-yl)undecanoyloxy]-2,5-dihydroxypyrrole-3-sulfinate |
|---|---|
| PubChem CID | 123259839 |
| Molecular Formula | C19H25N2O8S- |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 1-[11-(2,5-dioxopyrrol-1-yl)undecanoyloxy]-2,5-dihydroxypyrrole-3-sulfinate |
| SMILES | O=C(CCCCCCCCCCN1C(=O)C=CC1=O)On1c(O)cc(S(=O)[O-])c1O |
| InChI | InChI=1S/C19H26N2O8S/c22-15-10-11-16(23)20(15)12-8-6-4-2-1-3-5-7-9-18(25)29-21-17(24)13-14(19(21)26)30(27)28/h10-11,13,24,26H,1-9,12H2,(H,27,28)/p-1 |
| InChIKey | FETHIJZQKXIYDT-UHFFFAOYSA-M |
| XLogP | 1.53 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|