C10H17N3O7S — CID 123721025
1-[(2S)-2,6-diaminohexanoyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid (PubChem CID 123721025) has the molecular formula C10H17N3O7S and a molecular weight of 323.33 g/mol. Its IUPAC name is 1-[(2S)-2,6-diaminohexanoyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid.
| Compound Name | 1-[(2S)-2,6-diaminohexanoyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 123721025 |
| Molecular Formula | C10H17N3O7S |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 1-[(2S)-2,6-diaminohexanoyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid |
| SMILES | NCCCC[C@H](N)C(=O)On1c(O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C10H17N3O7S/c11-4-2-1-3-6(12)10(16)20-13-8(14)5-7(9(13)15)21(17,18)19/h5-6,14-15H,1-4,11-12H2,(H,17,18,19)/t6-/m0/s1 |
| InChIKey | CRGSGAXKIRFPAD-LURJTMIESA-N |
| XLogP | -1.44 |
| TPSA | 178.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|