C14H16N2O9S — CID 91361208
1-[4-(2,5-dioxopyrrol-1-yl)hexanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid (PubChem CID 91361208) has the molecular formula C14H16N2O9S and a molecular weight of 388.35 g/mol. Its IUPAC name is 1-[4-(2,5-dioxopyrrol-1-yl)hexanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid.
| Compound Name | 1-[4-(2,5-dioxopyrrol-1-yl)hexanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 91361208 |
| Molecular Formula | C14H16N2O9S |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 1-[4-(2,5-dioxopyrrol-1-yl)hexanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid |
| SMILES | CCC(CCC(=O)On1c(O)cc(S(=O)(=O)O)c1O)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C14H16N2O9S/c1-2-8(15-10(17)4-5-11(15)18)3-6-13(20)25-16-12(19)7-9(14(16)21)26(22,23)24/h4-5,7-8,19,21H,2-3,6H2,1H3,(H,22,23,24) |
| InChIKey | UNKCFKLTQMQCIQ-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 163.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|