C15H18N2O6 — CID 90686837
(2,5-dihydroxypyrrol-1-yl) 4-(2,5-dioxopyrrol-1-yl)-2-methylhexanoate (PubChem CID 90686837) has the molecular formula C15H18N2O6 and a molecular weight of 322.32 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-(2,5-dioxopyrrol-1-yl)-2-methylhexanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-(2,5-dioxopyrrol-1-yl)-2-methylhexanoate |
|---|---|
| PubChem CID | 90686837 |
| Molecular Formula | C15H18N2O6 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-(2,5-dioxopyrrol-1-yl)-2-methylhexanoate |
| SMILES | CCC(CC(C)C(=O)On1c(O)ccc1O)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C15H18N2O6/c1-3-10(16-11(18)4-5-12(16)19)8-9(2)15(22)23-17-13(20)6-7-14(17)21/h4-7,9-10,20-21H,3,8H2,1-2H3 |
| InChIKey | JSAPNGFUZFPVMX-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 109.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|