C16H22N2O8S — CID 54399383
1-[8-(2,5-dioxopyrrol-1-yl)octoxy]-2,5-dihydroxypyrrole-3-sulfonic acid (PubChem CID 54399383) has the molecular formula C16H22N2O8S and a molecular weight of 402.43 g/mol. Its IUPAC name is 1-[8-(2,5-dioxopyrrol-1-yl)octoxy]-2,5-dihydroxypyrrole-3-sulfonic acid.
| Compound Name | 1-[8-(2,5-dioxopyrrol-1-yl)octoxy]-2,5-dihydroxypyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 54399383 |
| Molecular Formula | C16H22N2O8S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 1-[8-(2,5-dioxopyrrol-1-yl)octoxy]-2,5-dihydroxypyrrole-3-sulfonic acid |
| SMILES | O=C1C=CC(=O)N1CCCCCCCCOn1c(O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C16H22N2O8S/c19-13-7-8-14(20)17(13)9-5-3-1-2-4-6-10-26-18-15(21)11-12(16(18)22)27(23,24)25/h7-8,11,21-22H,1-6,9-10H2,(H,23,24,25) |
| InChIKey | VMHWLLMVPQHJPV-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 146.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|