C12H14N2O8S — CID 57051631
1-[4-(2,5-dioxopyrrol-1-yl)butoxy]-2,5-dihydroxypyrrole-3-sulfonic acid (PubChem CID 57051631) has the molecular formula C12H14N2O8S and a molecular weight of 346.32 g/mol. Its IUPAC name is 1-[4-(2,5-dioxopyrrol-1-yl)butoxy]-2,5-dihydroxypyrrole-3-sulfonic acid.
| Compound Name | 1-[4-(2,5-dioxopyrrol-1-yl)butoxy]-2,5-dihydroxypyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 57051631 |
| Molecular Formula | C12H14N2O8S |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 1-[4-(2,5-dioxopyrrol-1-yl)butoxy]-2,5-dihydroxypyrrole-3-sulfonic acid |
| SMILES | O=C1C=CC(=O)N1CCCCOn1c(O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C12H14N2O8S/c15-9-3-4-10(16)13(9)5-1-2-6-22-14-11(17)7-8(12(14)18)23(19,20)21/h3-4,7,17-18H,1-2,5-6H2,(H,19,20,21) |
| InChIKey | ZCPASWONFNCKPO-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 146.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|