C11H10N2O9S — CID 91182632
1-[3-(2,5-dioxopyrrol-1-yl)propanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid (PubChem CID 91182632) has the molecular formula C11H10N2O9S and a molecular weight of 346.27 g/mol. Its IUPAC name is 1-[3-(2,5-dioxopyrrol-1-yl)propanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid.
| Compound Name | 1-[3-(2,5-dioxopyrrol-1-yl)propanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 91182632 |
| Molecular Formula | C11H10N2O9S |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 1-[3-(2,5-dioxopyrrol-1-yl)propanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid |
| SMILES | O=C(CCN1C(=O)C=CC1=O)On1c(O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C11H10N2O9S/c14-7-1-2-8(15)12(7)4-3-10(17)22-13-9(16)5-6(11(13)18)23(19,20)21/h1-2,5,16,18H,3-4H2,(H,19,20,21) |
| InChIKey | JSPNIIYSHJEQFF-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 163.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|