C12H14F3N3O9S — CID 123516183
2,5-dihydroxy-1-[3-[3-[(2,2,2-trifluoroacetyl)amino]propanoylamino]propanoyloxy]pyrrole-3-sulfonic acid (PubChem CID 123516183) has the molecular formula C12H14F3N3O9S and a molecular weight of 433.32 g/mol. Its IUPAC name is 2,5-dihydroxy-1-[3-[3-[(2,2,2-trifluoroacetyl)amino]propanoylamino]propanoyloxy]pyrrole-3-sulfonic acid.
| Compound Name | 2,5-dihydroxy-1-[3-[3-[(2,2,2-trifluoroacetyl)amino]propanoylamino]propanoyloxy]pyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 123516183 |
| Molecular Formula | C12H14F3N3O9S |
| Molecular Weight | 433.32 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | 2,5-dihydroxy-1-[3-[3-[(2,2,2-trifluoroacetyl)amino]propanoylamino]propanoyloxy]pyrrole-3-sulfonic acid |
| SMILES | O=C(CCNC(=O)C(F)(F)F)NCCC(=O)On1c(O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C12H14F3N3O9S/c13-12(14,15)11(23)17-3-1-7(19)16-4-2-9(21)27-18-8(20)5-6(10(18)22)28(24,25)26/h5,20,22H,1-4H2,(H,16,19)(H,17,23)(H,24,25,26) |
| InChIKey | ZMSVGCQHYCEABT-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 184.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.32 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|