C6H8N2O7S — CID 123449354
1-(2-aminoacetyl)oxy-2,5-dihydroxypyrrole-3-sulfonic acid (PubChem CID 123449354) has the molecular formula C6H8N2O7S and a molecular weight of 252.20 g/mol. Its IUPAC name is 1-(2-aminoacetyl)oxy-2,5-dihydroxypyrrole-3-sulfonic acid.
| Compound Name | 1-(2-aminoacetyl)oxy-2,5-dihydroxypyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 123449354 |
| Molecular Formula | C6H8N2O7S |
| Molecular Weight | 252.20 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | 1-(2-aminoacetyl)oxy-2,5-dihydroxypyrrole-3-sulfonic acid |
| SMILES | NCC(=O)On1c(O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C6H8N2O7S/c7-2-5(10)15-8-4(9)1-3(6(8)11)16(12,13)14/h1,9,11H,2,7H2,(H,12,13,14) |
| InChIKey | GMMJUEKQARYXDG-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 152.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.20 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|