C9H9F3N2O8S — CID 123316549
2,5-dihydroxy-1-[(2S)-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]oxypyrrole-3-sulfonic acid (PubChem CID 123316549) has the molecular formula C9H9F3N2O8S and a molecular weight of 362.24 g/mol. Its IUPAC name is 2,5-dihydroxy-1-[(2S)-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]oxypyrrole-3-sulfonic acid.
| Compound Name | 2,5-dihydroxy-1-[(2S)-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]oxypyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 123316549 |
| Molecular Formula | C9H9F3N2O8S |
| Molecular Weight | 362.24 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | 2,5-dihydroxy-1-[(2S)-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]oxypyrrole-3-sulfonic acid |
| SMILES | C[C@H](NC(=O)C(F)(F)F)C(=O)On1c(O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C9H9F3N2O8S/c1-3(13-8(18)9(10,11)12)7(17)22-14-5(15)2-4(6(14)16)23(19,20)21/h2-3,15-16H,1H3,(H,13,18)(H,19,20,21)/t3-/m0/s1 |
| InChIKey | YDYNEGHUADQUDH-VKHMYHEASA-N |
| XLogP | -0.83 |
| TPSA | 155.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.24 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|