C15H19N3O11S3 — CID 57297864
1-[2,3-bis[(2-acetylsulfanylacetyl)amino]propanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid (PubChem CID 57297864) has the molecular formula C15H19N3O11S3 and a molecular weight of 513.53 g/mol. Its IUPAC name is 1-[2,3-bis[(2-acetylsulfanylacetyl)amino]propanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid.
| Compound Name | 1-[2,3-bis[(2-acetylsulfanylacetyl)amino]propanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 57297864 |
| Molecular Formula | C15H19N3O11S3 |
| Molecular Weight | 513.53 g/mol |
| Exact Mass | 513.02 |
| IUPAC Name | 1-[2,3-bis[(2-acetylsulfanylacetyl)amino]propanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid |
| SMILES | CC(=O)SCC(=O)NCC(NC(=O)CSC(C)=O)C(=O)On1c(O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C15H19N3O11S3/c1-7(19)30-5-11(21)16-4-9(17-12(22)6-31-8(2)20)15(25)29-18-13(23)3-10(14(18)24)32(26,27)28/h3,9,23-24H,4-6H2,1-2H3,(H,16,21)(H,17,22)(H,26,27,28) |
| InChIKey | VGZNHBTXUWZFNU-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 218.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.53 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|