C24H41N7O11S3 — CID 123266951
2-[2,6-bis(4-aminosulfanylbutanoylamino)hexanoylamino]-3-[[3-(2,5-dihydroxypyrrol-1-yl)oxy-3-oxopropyl]amino]-3-oxopropane-1-sulfonic acid (PubChem CID 123266951) has the molecular formula C24H41N7O11S3 and a molecular weight of 699.83 g/mol. Its IUPAC name is 2-[2,6-bis(4-aminosulfanylbutanoylamino)hexanoylamino]-3-[[3-(2,5-dihydroxypyrrol-1-yl)oxy-3-oxopropyl]amino]-3-oxopropane-1-sulfonic acid.
| Compound Name | 2-[2,6-bis(4-aminosulfanylbutanoylamino)hexanoylamino]-3-[[3-(2,5-dihydroxypyrrol-1-yl)oxy-3-oxopropyl]amino]-3-oxopropane-1-sulfonic acid |
|---|---|
| PubChem CID | 123266951 |
| Molecular Formula | C24H41N7O11S3 |
| Molecular Weight | 699.83 g/mol |
| Exact Mass | 699.20 |
| IUPAC Name | 2-[2,6-bis(4-aminosulfanylbutanoylamino)hexanoylamino]-3-[[3-(2,5-dihydroxypyrrol-1-yl)oxy-3-oxopropyl]amino]-3-oxopropane-1-sulfonic acid |
| SMILES | NSCCCC(=O)NCCCCC(NC(=O)CCCSN)C(=O)NC(CS(=O)(=O)O)C(=O)NCCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C24H41N7O11S3/c25-43-13-3-6-18(32)27-11-2-1-5-16(29-19(33)7-4-14-44-26)24(38)30-17(15-45(39,40)41)23(37)28-12-10-22(36)42-31-20(34)8-9-21(31)35/h8-9,16-17,34-35H,1-7,10-15,25-26H2,(H,27,32)(H,28,37)(H,29,33)(H,30,38)(H,39,40,41) |
| InChIKey | BEOWPPXYDRXVDT-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 294.50 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.83 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|